C11H14N5O4P — CID 175453370
2-(6-aminopurin-9-yl)-5-(phosphorosomethoxymethyl)oxolan-3-ol (PubChem CID 175453370) has the molecular formula C11H14N5O4P and a molecular weight of 311.24 g/mol. Its IUPAC name is 2-(6-aminopurin-9-yl)-5-(phosphorosomethoxymethyl)oxolan-3-ol.
| Compound Name | 2-(6-aminopurin-9-yl)-5-(phosphorosomethoxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 175453370 |
| Molecular Formula | C11H14N5O4P |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2-(6-aminopurin-9-yl)-5-(phosphorosomethoxymethyl)oxolan-3-ol |
| SMILES | Nc1ncnc2c1ncn2C1OC(COCP=O)CC1O |
| InChI | InChI=1S/C11H14N5O4P/c12-9-8-10(14-3-13-9)16(4-15-8)11-7(17)1-6(20-11)2-19-5-21-18/h3-4,6-7,11,17H,1-2,5H2,(H2,12,13,14) |
| InChIKey | VEORAPSFONSBDB-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|