C10H13N5O5 — CID 88990119
9-[3-hydroperoxy-5-(hydroperoxymethyl)oxolan-2-yl]purin-6-amine (PubChem CID 88990119) has the molecular formula C10H13N5O5 and a molecular weight of 283.24 g/mol. Its IUPAC name is 9-[3-hydroperoxy-5-(hydroperoxymethyl)oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[3-hydroperoxy-5-(hydroperoxymethyl)oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 88990119 |
| Molecular Formula | C10H13N5O5 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 9-[3-hydroperoxy-5-(hydroperoxymethyl)oxolan-2-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2C1OC(COO)CC1OO |
| InChI | InChI=1S/C10H13N5O5/c11-8-7-9(13-3-12-8)15(4-14-7)10-6(20-17)1-5(19-10)2-18-16/h3-6,10,16-17H,1-2H2,(H2,11,12,13) |
| InChIKey | RFFCOHWGOZBJHU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 137.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|