C13H20N5O5P — CID 144900448
[5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl propan-2-yl hydrogen phosphite (PubChem CID 144900448) has the molecular formula C13H20N5O5P and a molecular weight of 357.31 g/mol. Its IUPAC name is [5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl propan-2-yl hydrogen phosphite.
| Compound Name | [5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl propan-2-yl hydrogen phosphite |
|---|---|
| PubChem CID | 144900448 |
| Molecular Formula | C13H20N5O5P |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | [5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl propan-2-yl hydrogen phosphite |
| SMILES | CC(C)OP(O)OCC1CC(O)C(n2cnc3c(N)ncnc32)O1 |
| InChI | InChI=1S/C13H20N5O5P/c1-7(2)23-24(20)21-4-8-3-9(19)13(22-8)18-6-17-10-11(14)15-5-16-12(10)18/h5-9,13,19-20H,3-4H2,1-2H3,(H2,14,15,16) |
| InChIKey | BUKRVKXRSRHGTC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 137.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|