C21H32N5O10P — CID 171428871
[[(2S,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methoxymethyl-(2-methylpropanoyloxymethoxy)phosphoryl]oxymethyl 2-methylpropanoate (PubChem CID 171428871) has the molecular formula C21H32N5O10P and a molecular weight of 545.49 g/mol. Its IUPAC name is [[(2S,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methoxymethyl-(2-methylpropanoyloxymethoxy)phosphoryl]oxymethyl 2-methylpropanoate.
| Compound Name | [[(2S,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methoxymethyl-(2-methylpropanoyloxymethoxy)phosphoryl]oxymethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 171428871 |
| Molecular Formula | C21H32N5O10P |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | [[(2S,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methoxymethyl-(2-methylpropanoyloxymethoxy)phosphoryl]oxymethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCOP(=O)(COC[C@@H]1CC(O)[C@H](n2cnc3c(N)ncnc32)O1)OCOC(=O)C(C)C |
| InChI | InChI=1S/C21H32N5O10P/c1-12(2)20(28)32-9-34-37(30,35-10-33-21(29)13(3)4)11-31-6-14-5-15(27)19(36-14)26-8-25-16-17(22)23-7-24-18(16)26/h7-8,12-15,19,27H,5-6,9-11H2,1-4H3,(H2,22,23,24)/t14-,15?,19+/m0/s1 |
| InChIKey | VTQMOTJZCHQUSQ-CTHAPGQVSA-N |
| XLogP | 1.57 |
| TPSA | 196.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|