C18H27N5O4 — CID 66553231
[(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl octanoate (PubChem CID 66553231) has the molecular formula C18H27N5O4 and a molecular weight of 377.45 g/mol. Its IUPAC name is [(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl octanoate.
| Compound Name | [(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl octanoate |
|---|---|
| PubChem CID | 66553231 |
| Molecular Formula | C18H27N5O4 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | [(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OC[C@@H]1C[C@@H](O)[C@H](n2cnc3c(N)ncnc32)O1 |
| InChI | InChI=1S/C18H27N5O4/c1-2-3-4-5-6-7-14(25)26-9-12-8-13(24)18(27-12)23-11-22-15-16(19)20-10-21-17(15)23/h10-13,18,24H,2-9H2,1H3,(H2,19,20,21)/t12-,13+,18+/m0/s1 |
| InChIKey | WPFGTBDHWOUSBO-VEVIJQCQSA-N |
| XLogP | 1.96 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|