C30H48N4O6 — CID 135968504
[(2S,4R,5R)-4-decanoyloxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl decanoate (PubChem CID 135968504) has the molecular formula C30H48N4O6 and a molecular weight of 560.74 g/mol. Its IUPAC name is [(2S,4R,5R)-4-decanoyloxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl decanoate.
| Compound Name | [(2S,4R,5R)-4-decanoyloxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl decanoate |
|---|---|
| PubChem CID | 135968504 |
| Molecular Formula | C30H48N4O6 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.36 |
| IUPAC Name | [(2S,4R,5R)-4-decanoyloxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl decanoate |
| SMILES | CCCCCCCCCC(=O)OC[C@@H]1C[C@@H](OC(=O)CCCCCCCCC)[C@H](n2cnc3c(=O)[nH]cnc32)O1 |
| InChI | InChI=1S/C30H48N4O6/c1-3-5-7-9-11-13-15-17-25(35)38-20-23-19-24(40-26(36)18-16-14-12-10-8-6-4-2)30(39-23)34-22-33-27-28(34)31-21-32-29(27)37/h21-24,30H,3-20H2,1-2H3,(H,31,32,37)/t23-,24+,30+/m0/s1 |
| InChIKey | KRHIQNGJRCRYIG-FVBCXUTKSA-N |
| XLogP | 6.14 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|