C10H10N4O4Si2 — CID 135964997
CID 135964997 (PubChem CID 135964997) has the molecular formula C10H10N4O4Si2 and a molecular weight of 306.39 g/mol.
| Compound Name | CID 135964997 |
|---|---|
| PubChem CID | 135964997 |
| Molecular Formula | C10H10N4O4Si2 |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | — |
| SMILES | O=c1[nH]cnc2c1ncn2[C@@H]1O[C@H](CO[Si])C[C@H]1O[Si] |
| InChI | InChI=1S/C10H10N4O4Si2/c15-9-7-8(11-3-12-9)14(4-13-7)10-6(18-20)1-5(17-10)2-16-19/h3-6,10H,1-2H2,(H,11,12,15)/t5-,6+,10+/m0/s1 |
| InChIKey | RBHJKWDOTSNQBE-BAJZRUMYSA-N |
| XLogP | -1.02 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|