C10H12FN5O5S — CID 147118177
[(2S,4R,5R)-4-fluoro-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methylsulfamic acid (PubChem CID 147118177) has the molecular formula C10H12FN5O5S and a molecular weight of 333.30 g/mol. Its IUPAC name is [(2S,4R,5R)-4-fluoro-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methylsulfamic acid.
| Compound Name | [(2S,4R,5R)-4-fluoro-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methylsulfamic acid |
|---|---|
| PubChem CID | 147118177 |
| Molecular Formula | C10H12FN5O5S |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | [(2S,4R,5R)-4-fluoro-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methylsulfamic acid |
| SMILES | O=c1[nH]cnc2c1ncn2[C@@H]1O[C@H](CNS(=O)(=O)O)C[C@H]1F |
| InChI | InChI=1S/C10H12FN5O5S/c11-6-1-5(2-15-22(18,19)20)21-10(6)16-4-14-7-8(16)12-3-13-9(7)17/h3-6,10,15H,1-2H2,(H,12,13,17)(H,18,19,20)/t5-,6+,10+/m0/s1 |
| InChIKey | BNVJKIJRECEFHN-BAJZRUMYSA-N |
| XLogP | -0.86 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|