C18H27N5O6 — CID 136998534
[2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] octanoate (PubChem CID 136998534) has the molecular formula C18H27N5O6 and a molecular weight of 409.44 g/mol. Its IUPAC name is [2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] octanoate.
| Compound Name | [2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] octanoate |
|---|---|
| PubChem CID | 136998534 |
| Molecular Formula | C18H27N5O6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | [2-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)OC1C(O)C(CO)OC1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C18H27N5O6/c1-2-3-4-5-6-7-11(25)29-14-13(26)10(8-24)28-17(14)23-9-20-12-15(23)21-18(19)22-16(12)27/h9-10,13-14,17,24,26H,2-8H2,1H3,(H3,19,21,22,27) |
| InChIKey | APHMYBFHRYMEFE-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 165.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|