C13H13F2N5O4 — CID 66556212
(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-3-(3,3-difluoropropa-1,2-dienyl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 66556212) has the molecular formula C13H13F2N5O4 and a molecular weight of 341.27 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-3-(3,3-difluoropropa-1,2-dienyl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-3-(3,3-difluoropropa-1,2-dienyl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 66556212 |
| Molecular Formula | C13H13F2N5O4 |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-3-(3,3-difluoropropa-1,2-dienyl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@]1(O)C=C=C(F)F |
| InChI | InChI=1S/C13H13F2N5O4/c14-7(15)1-2-13(23)9(22)6(3-21)24-12(13)20-5-19-8-10(16)17-4-18-11(8)20/h2,4-6,9,12,21-23H,3H2,(H2,16,17,18)/t6-,9-,12-,13-/m1/s1 |
| InChIKey | BQXOROJFYJCUGY-PKYQGKNXSA-N |
| XLogP | -0.67 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |