C10H10F2N8O2 — CID 71354368
[(2S,3R,5R)-5-(6-aminopurin-9-yl)-3-azido-4,4-difluorooxolan-2-yl]methanol (PubChem CID 71354368) has the molecular formula C10H10F2N8O2 and a molecular weight of 312.24 g/mol. Its IUPAC name is [(2S,3R,5R)-5-(6-aminopurin-9-yl)-3-azido-4,4-difluorooxolan-2-yl]methanol.
| Compound Name | [(2S,3R,5R)-5-(6-aminopurin-9-yl)-3-azido-4,4-difluorooxolan-2-yl]methanol |
|---|---|
| PubChem CID | 71354368 |
| Molecular Formula | C10H10F2N8O2 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | [(2S,3R,5R)-5-(6-aminopurin-9-yl)-3-azido-4,4-difluorooxolan-2-yl]methanol |
| SMILES | [N-]=[N+]=N[C@@H]1[C@@H](CO)O[C@@H](n2cnc3c(N)ncnc32)C1(F)F |
| InChI | InChI=1S/C10H10F2N8O2/c11-10(12)6(18-19-14)4(1-21)22-9(10)20-3-17-5-7(13)15-2-16-8(5)20/h2-4,6,9,21H,1H2,(H2,13,15,16)/t4-,6-,9-/m1/s1 |
| InChIKey | FJNQEWZFGQRYHO-NVMQTXNBSA-N |
| XLogP | 0.61 |
| TPSA | 147.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|