C13H21N5O4Si — CID 175851034
(2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-3-trimethylsilyloxolane-3,4-diol (PubChem CID 175851034) has the molecular formula C13H21N5O4Si and a molecular weight of 339.43 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-3-trimethylsilyloxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-3-trimethylsilyloxolane-3,4-diol |
|---|---|
| PubChem CID | 175851034 |
| Molecular Formula | C13H21N5O4Si |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | (2R,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-3-trimethylsilyloxolane-3,4-diol |
| SMILES | C[Si](C)(C)[C@@]1(O)[C@H](O)[C@@H](CO)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H21N5O4Si/c1-23(2,3)13(21)9(20)7(4-19)22-12(13)18-6-17-8-10(14)15-5-16-11(8)18/h5-7,9,12,19-21H,4H2,1-3H3,(H2,14,15,16)/t7-,9-,12-,13+/m1/s1 |
| InChIKey | XYQJKMVMDMDGSO-HLXLPKMUSA-N |
| XLogP | -0.73 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|