C20H33N5O4 — CID 70522706
(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-3,4-dipentyloxolane-3,4-diol (PubChem CID 70522706) has the molecular formula C20H33N5O4 and a molecular weight of 407.52 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-3,4-dipentyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-3,4-dipentyloxolane-3,4-diol |
|---|---|
| PubChem CID | 70522706 |
| Molecular Formula | C20H33N5O4 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | (2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)-3,4-dipentyloxolane-3,4-diol |
| SMILES | CCCCC[C@@]1(O)[C@@H](CO)O[C@@H](n2cnc3c(N)ncnc32)[C@@]1(O)CCCCC |
| InChI | InChI=1S/C20H33N5O4/c1-3-5-7-9-19(27)14(11-26)29-18(20(19,28)10-8-6-4-2)25-13-24-15-16(21)22-12-23-17(15)25/h12-14,18,26-28H,3-11H2,1-2H3,(H2,21,22,23)/t14-,18-,19-,20+/m1/s1 |
| InChIKey | UFXKBZIYOLYZGJ-DMSXTEQDSA-N |
| XLogP | 1.92 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|