C32H26ClN5O7 — CID 91338447
[(2R,4R)-5-(2-amino-6-chloropurin-9-yl)-3,4-dibenzoyloxy-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 91338447) has the molecular formula C32H26ClN5O7 and a molecular weight of 628.04 g/mol. Its IUPAC name is [(2R,4R)-5-(2-amino-6-chloropurin-9-yl)-3,4-dibenzoyloxy-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,4R)-5-(2-amino-6-chloropurin-9-yl)-3,4-dibenzoyloxy-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 91338447 |
| Molecular Formula | C32H26ClN5O7 |
| Molecular Weight | 628.04 g/mol |
| Exact Mass | 627.15 |
| IUPAC Name | [(2R,4R)-5-(2-amino-6-chloropurin-9-yl)-3,4-dibenzoyloxy-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | C[C@@]1(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)OC1n1cnc2c(Cl)nc(N)nc21 |
| InChI | InChI=1S/C32H26ClN5O7/c1-32(45-29(41)21-15-9-4-10-16-21)24(44-28(40)20-13-7-3-8-14-20)22(17-42-27(39)19-11-5-2-6-12-19)43-30(32)38-18-35-23-25(33)36-31(34)37-26(23)38/h2-16,18,22,24,30H,17H2,1H3,(H2,34,36,37)/t22-,24?,30?,32-/m1/s1 |
| InChIKey | HHGHJWFDGDHDSS-DLQGWDLKSA-N |
| XLogP | 4.66 |
| TPSA | 157.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.04 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|