C30H25ClN2O7 — CID 141110067
[(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(4-chloroimidazol-1-yl)-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 141110067) has the molecular formula C30H25ClN2O7 and a molecular weight of 560.99 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(4-chloroimidazol-1-yl)-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(4-chloroimidazol-1-yl)-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 141110067 |
| Molecular Formula | C30H25ClN2O7 |
| Molecular Weight | 560.99 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-dibenzoyloxy-5-(4-chloroimidazol-1-yl)-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | C[C@@]1(OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)O[C@H]1n1cnc(Cl)c1 |
| InChI | InChI=1S/C30H25ClN2O7/c1-30(40-28(36)22-15-9-4-10-16-22)25(39-27(35)21-13-7-3-8-14-21)23(38-29(30)33-17-24(31)32-19-33)18-37-26(34)20-11-5-2-6-12-20/h2-17,19,23,25,29H,18H2,1H3/t23-,25-,29-,30-/m1/s1 |
| InChIKey | IUMWCYHUHDSUJC-FNXLTKCDSA-N |
| XLogP | 5.13 |
| TPSA | 105.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.99 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|