C32H28N2O8 — CID 174003633
[(2R,3S,5R)-3,4-dibenzoyloxy-4-methyl-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate (PubChem CID 174003633) has the molecular formula C32H28N2O8 and a molecular weight of 568.58 g/mol. Its IUPAC name is [(2R,3S,5R)-3,4-dibenzoyloxy-4-methyl-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,5R)-3,4-dibenzoyloxy-4-methyl-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 174003633 |
| Molecular Formula | C32H28N2O8 |
| Molecular Weight | 568.58 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | [(2R,3S,5R)-3,4-dibenzoyloxy-4-methyl-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methyl benzoate |
| SMILES | C=C1NC(=O)C=CN1[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)C1(C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H28N2O8/c1-21-33-26(35)18-19-34(21)31-32(2,42-30(38)24-16-10-5-11-17-24)27(41-29(37)23-14-8-4-9-15-23)25(40-31)20-39-28(36)22-12-6-3-7-13-22/h3-19,25,27,31H,1,20H2,2H3,(H,33,35)/t25-,27+,31-,32?/m1/s1 |
| InChIKey | XKZMUWWADXZNOR-GQDQBXHOSA-N |
| XLogP | 3.83 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|