C34H26BrN3O9 — CID 90334077
[(2R,4R,5R)-3,4-dibenzoyloxy-5-(6-bromo-2,7-dioxo-8H-pyrido[2,3-d]pyrimidin-3-yl)-4-methyloxolan-2-yl]methyl benzoate (PubChem CID 90334077) has the molecular formula C34H26BrN3O9 and a molecular weight of 700.50 g/mol. Its IUPAC name is [(2R,4R,5R)-3,4-dibenzoyloxy-5-(6-bromo-2,7-dioxo-8H-pyrido[2,3-d]pyrimidin-3-yl)-4-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,4R,5R)-3,4-dibenzoyloxy-5-(6-bromo-2,7-dioxo-8H-pyrido[2,3-d]pyrimidin-3-yl)-4-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 90334077 |
| Molecular Formula | C34H26BrN3O9 |
| Molecular Weight | 700.50 g/mol |
| Exact Mass | 699.09 |
| IUPAC Name | [(2R,4R,5R)-3,4-dibenzoyloxy-5-(6-bromo-2,7-dioxo-8H-pyrido[2,3-d]pyrimidin-3-yl)-4-methyloxolan-2-yl]methyl benzoate |
| SMILES | C[C@@]1(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)O[C@H]1n1cc2cc(Br)c(=O)[nH]c2nc1=O |
| InChI | InChI=1S/C34H26BrN3O9/c1-34(47-31(42)22-15-9-4-10-16-22)26(46-30(41)21-13-7-3-8-14-21)25(19-44-29(40)20-11-5-2-6-12-20)45-32(34)38-18-23-17-24(35)28(39)36-27(23)37-33(38)43/h2-18,25-26,32H,19H2,1H3,(H,36,37,39,43)/t25-,26?,32-,34-/m1/s1 |
| InChIKey | QODCRBNSOWZLOC-KSTLNPGBSA-N |
| XLogP | 4.44 |
| TPSA | 155.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|