C14H19N5O6S — CID 123799522
[3-(2-amino-6-ethoxypurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methyl methanesulfonate (PubChem CID 123799522) has the molecular formula C14H19N5O6S and a molecular weight of 385.40 g/mol. Its IUPAC name is [3-(2-amino-6-ethoxypurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methyl methanesulfonate.
| Compound Name | [3-(2-amino-6-ethoxypurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 123799522 |
| Molecular Formula | C14H19N5O6S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | [3-(2-amino-6-ethoxypurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methyl methanesulfonate |
| SMILES | CCOc1nc(N)nc2c1ncn2C1OC2(COS(C)(=O)=O)COC1C2 |
| InChI | InChI=1S/C14H19N5O6S/c1-3-22-11-9-10(17-13(15)18-11)19(7-16-9)12-8-4-14(25-12,5-23-8)6-24-26(2,20)21/h7-8,12H,3-6H2,1-2H3,(H2,15,17,18) |
| InChIKey | MLUIACRSJIKBMS-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|