C12H16N6O4P+ — CID 160733150
[(1R,3R,4R)-3-(2,6-diaminopurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methyl-oxophosphanium (PubChem CID 160733150) has the molecular formula C12H16N6O4P+ and a molecular weight of 339.27 g/mol. Its IUPAC name is [(1R,3R,4R)-3-(2,6-diaminopurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methyl-oxophosphanium.
| Compound Name | [(1R,3R,4R)-3-(2,6-diaminopurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methyl-oxophosphanium |
|---|---|
| PubChem CID | 160733150 |
| Molecular Formula | C12H16N6O4P+ |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | [(1R,3R,4R)-3-(2,6-diaminopurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methyl-oxophosphanium |
| SMILES | C[P+](=O)OC[C@]12CO[C@H](C1)[C@H](n1cnc3c(N)nc(N)nc31)O2 |
| InChI | InChI=1S/C12H16N6O4P/c1-23(19)21-4-12-2-6(20-3-12)10(22-12)18-5-15-7-8(13)16-11(14)17-9(7)18/h5-6,10H,2-4H2,1H3,(H4,13,14,16,17)/q+1/t6-,10-,12-/m1/s1 |
| InChIKey | MGWKBJLLGKMACM-KXHDPYLZSA-N |
| XLogP | 0.44 |
| TPSA | 140.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|