C11H16N9O12P3 — CID 90125367
[[(1R,3R,4R,7S)-7-azido-3-(2,6-diaminopurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90125367) has the molecular formula C11H16N9O12P3 and a molecular weight of 559.22 g/mol. Its IUPAC name is [[(1R,3R,4R,7S)-7-azido-3-(2,6-diaminopurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1R,3R,4R,7S)-7-azido-3-(2,6-diaminopurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90125367 |
| Molecular Formula | C11H16N9O12P3 |
| Molecular Weight | 559.22 g/mol |
| Exact Mass | 559.01 |
| IUPAC Name | [[(1R,3R,4R,7S)-7-azido-3-(2,6-diaminopurin-9-yl)-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [N-]=[N+]=N[C@H]1[C@H]2OC[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]2n1cnc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C11H16N9O12P3/c12-7-4-8(17-10(13)16-7)20(3-15-4)9-5-6(18-19-14)11(30-9,1-28-5)2-29-34(24,25)32-35(26,27)31-33(21,22)23/h3,5-6,9H,1-2H2,(H,24,25)(H,26,27)(H2,21,22,23)(H4,12,13,16,17)/t5-,6+,9-,11-/m1/s1 |
| InChIKey | ZDVLTUGVUNTCBU-HLJYALQUSA-N |
| XLogP | -0.32 |
| TPSA | 322.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.22 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|