C11H15FN5O12P3 — CID 90125328
[[(1R,3R,4S,7S)-3-(6-aminopurin-9-yl)-7-fluoro-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90125328) has the molecular formula C11H15FN5O12P3 and a molecular weight of 521.18 g/mol. Its IUPAC name is [[(1R,3R,4S,7S)-3-(6-aminopurin-9-yl)-7-fluoro-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1R,3R,4S,7S)-3-(6-aminopurin-9-yl)-7-fluoro-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90125328 |
| Molecular Formula | C11H15FN5O12P3 |
| Molecular Weight | 521.18 g/mol |
| Exact Mass | 520.99 |
| IUPAC Name | [[(1R,3R,4S,7S)-3-(6-aminopurin-9-yl)-7-fluoro-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@@]2(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)CO[C@@H]1[C@@H]2F |
| InChI | InChI=1S/C11H15FN5O12P3/c12-7-6-10(17-4-16-5-8(13)14-3-15-9(5)17)27-11(7,1-25-6)2-26-31(21,22)29-32(23,24)28-30(18,19)20/h3-4,6-7,10H,1-2H2,(H,21,22)(H,23,24)(H2,13,14,15)(H2,18,19,20)/t6-,7+,10-,11-/m1/s1 |
| InChIKey | XRVBMCAPEYFDPD-LRMGWDNHSA-N |
| XLogP | -0.24 |
| TPSA | 247.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.18 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|