C13H18N5O6P — CID 123868370
[(1R,3R,4S)-3-(6-aminopurin-9-yl)-7-methoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methylphosphinic acid (PubChem CID 123868370) has the molecular formula C13H18N5O6P and a molecular weight of 371.29 g/mol. Its IUPAC name is [(1R,3R,4S)-3-(6-aminopurin-9-yl)-7-methoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methylphosphinic acid.
| Compound Name | [(1R,3R,4S)-3-(6-aminopurin-9-yl)-7-methoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 123868370 |
| Molecular Formula | C13H18N5O6P |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | [(1R,3R,4S)-3-(6-aminopurin-9-yl)-7-methoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-methylphosphinic acid |
| SMILES | COC1[C@@H]2OC[C@]1(COP(C)(=O)O)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H18N5O6P/c1-21-9-8-12(18-6-17-7-10(14)15-5-16-11(7)18)24-13(9,3-22-8)4-23-25(2,19)20/h5-6,8-9,12H,3-4H2,1-2H3,(H,19,20)(H2,14,15,16)/t8-,9?,12+,13+/m0/s1 |
| InChIKey | PGFCXSDRADUWQR-NPJNEXAHSA-N |
| XLogP | -0.08 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|