C14H20N5O5PS — CID 88951944
9-[(5S,7R)-5-ethyl-8-[hydroxy(methoxy)phosphinothioyl]oxy-2,6-dioxabicyclo[3.2.1]octan-7-yl]purin-6-amine (PubChem CID 88951944) has the molecular formula C14H20N5O5PS and a molecular weight of 401.39 g/mol. Its IUPAC name is 9-[(5S,7R)-5-ethyl-8-[hydroxy(methoxy)phosphinothioyl]oxy-2,6-dioxabicyclo[3.2.1]octan-7-yl]purin-6-amine.
| Compound Name | 9-[(5S,7R)-5-ethyl-8-[hydroxy(methoxy)phosphinothioyl]oxy-2,6-dioxabicyclo[3.2.1]octan-7-yl]purin-6-amine |
|---|---|
| PubChem CID | 88951944 |
| Molecular Formula | C14H20N5O5PS |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 9-[(5S,7R)-5-ethyl-8-[hydroxy(methoxy)phosphinothioyl]oxy-2,6-dioxabicyclo[3.2.1]octan-7-yl]purin-6-amine |
| SMILES | CC[C@]12CCOC(C1OP(O)(=S)OC)[C@H](n1cnc3c(N)ncnc31)O2 |
| InChI | InChI=1S/C14H20N5O5PS/c1-3-14-4-5-22-9(10(14)24-25(20,26)21-2)13(23-14)19-7-18-8-11(15)16-6-17-12(8)19/h6-7,9-10,13H,3-5H2,1-2H3,(H,20,26)(H2,15,16,17)/t9?,10?,13-,14+,25?/m1/s1 |
| InChIKey | XCRWZZLBELMQNA-VMXQLTIJSA-N |
| XLogP | 1.12 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|