C14H19N5O4 — CID 59133676
9-[(3aR,5R,6S)-6-methoxy-3a-(methoxymethyl)-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-yl]purin-6-amine (PubChem CID 59133676) has the molecular formula C14H19N5O4 and a molecular weight of 321.34 g/mol. Its IUPAC name is 9-[(3aR,5R,6S)-6-methoxy-3a-(methoxymethyl)-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-yl]purin-6-amine.
| Compound Name | 9-[(3aR,5R,6S)-6-methoxy-3a-(methoxymethyl)-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-yl]purin-6-amine |
|---|---|
| PubChem CID | 59133676 |
| Molecular Formula | C14H19N5O4 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 9-[(3aR,5R,6S)-6-methoxy-3a-(methoxymethyl)-3,5,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-yl]purin-6-amine |
| SMILES | COC[C@]12CCOC1[C@H](OC)[C@H](n1cnc3c(N)ncnc31)O2 |
| InChI | InChI=1S/C14H19N5O4/c1-20-5-14-3-4-22-10(14)9(21-2)13(23-14)19-7-18-8-11(15)16-6-17-12(8)19/h6-7,9-10,13H,3-5H2,1-2H3,(H2,15,16,17)/t9-,10?,13+,14+/m0/s1 |
| InChIKey | SKYJWHZBKXVGQR-AIHGEPKZSA-N |
| XLogP | 0.13 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |