C15H21N5O2 — CID 58159391
9-[(5S,7R,8R)-5,8-diethyl-2,6-dioxabicyclo[3.2.1]octan-7-yl]purin-6-amine (PubChem CID 58159391) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 9-[(5S,7R,8R)-5,8-diethyl-2,6-dioxabicyclo[3.2.1]octan-7-yl]purin-6-amine.
| Compound Name | 9-[(5S,7R,8R)-5,8-diethyl-2,6-dioxabicyclo[3.2.1]octan-7-yl]purin-6-amine |
|---|---|
| PubChem CID | 58159391 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 9-[(5S,7R,8R)-5,8-diethyl-2,6-dioxabicyclo[3.2.1]octan-7-yl]purin-6-amine |
| SMILES | CC[C@@H]1C2OCC[C@]1(CC)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C15H21N5O2/c1-3-9-11-14(22-15(9,4-2)5-6-21-11)20-8-19-10-12(16)17-7-18-13(10)20/h7-9,11,14H,3-6H2,1-2H3,(H2,16,17,18)/t9-,11?,14-,15+/m1/s1 |
| InChIKey | ODTNQMMBQAWKJN-ZSEYQKITSA-N |
| XLogP | 1.90 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |