C15H19N5O4 — CID 164935277
[(4S,6aS)-6-(6-aminopurin-9-yl)-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-yl]methanol (PubChem CID 164935277) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is [(4S,6aS)-6-(6-aminopurin-9-yl)-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-yl]methanol.
| Compound Name | [(4S,6aS)-6-(6-aminopurin-9-yl)-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-yl]methanol |
|---|---|
| PubChem CID | 164935277 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | [(4S,6aS)-6-(6-aminopurin-9-yl)-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-yl]methanol |
| SMILES | CC1(C)OC2[C@H](O1)C(n1cnc3c(N)ncnc31)O[C@]21CC1CO |
| InChI | InChI=1S/C15H19N5O4/c1-14(2)22-9-10(23-14)15(3-7(15)4-21)24-13(9)20-6-19-8-11(16)17-5-18-12(8)20/h5-7,9-10,13,21H,3-4H2,1-2H3,(H2,16,17,18)/t7?,9-,10?,13?,15-/m0/s1 |
| InChIKey | DAHFCKPYPKVYLB-WHLYXLSDSA-N |
| XLogP | 0.21 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |