C16H21N5O3 — CID 167591593
9-[(6R,6aS)-2,2,3'-trimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,1'-cyclobutane]-6-yl]purin-6-amine (PubChem CID 167591593) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 9-[(6R,6aS)-2,2,3'-trimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,1'-cyclobutane]-6-yl]purin-6-amine.
| Compound Name | 9-[(6R,6aS)-2,2,3'-trimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,1'-cyclobutane]-6-yl]purin-6-amine |
|---|---|
| PubChem CID | 167591593 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 9-[(6R,6aS)-2,2,3'-trimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,1'-cyclobutane]-6-yl]purin-6-amine |
| SMILES | CC1CC2(C1)O[C@@H](n1cnc3c(N)ncnc31)[C@H]1OC(C)(C)OC12 |
| InChI | InChI=1S/C16H21N5O3/c1-8-4-16(5-8)11-10(22-15(2,3)23-11)14(24-16)21-7-20-9-12(17)18-6-19-13(9)21/h6-8,10-11,14H,4-5H2,1-3H3,(H2,17,18,19)/t8?,10-,11?,14+,16?/m0/s1 |
| InChIKey | KSXCXEMLRMBCAU-AFMYZVFRSA-N |
| XLogP | 1.63 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |