C15H18N8O3 — CID 164935027
9-[(3aS,6R,6aR)-3'-azido-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,1'-cyclobutane]-6-yl]purin-6-amine (PubChem CID 164935027) has the molecular formula C15H18N8O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is 9-[(3aS,6R,6aR)-3'-azido-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,1'-cyclobutane]-6-yl]purin-6-amine.
| Compound Name | 9-[(3aS,6R,6aR)-3'-azido-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,1'-cyclobutane]-6-yl]purin-6-amine |
|---|---|
| PubChem CID | 164935027 |
| Molecular Formula | C15H18N8O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 9-[(3aS,6R,6aR)-3'-azido-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,1'-cyclobutane]-6-yl]purin-6-amine |
| SMILES | CC1(C)O[C@H]2[C@H](n3cnc4c(N)ncnc43)OC3(CC(N=[N+]=[N-])C3)[C@H]2O1 |
| InChI | InChI=1S/C15H18N8O3/c1-14(2)24-9-10(25-14)15(3-7(4-15)21-22-17)26-13(9)23-6-20-8-11(16)18-5-19-12(8)23/h5-7,9-10,13H,3-4H2,1-2H3,(H2,16,18,19)/t7?,9-,10+,13-,15?/m1/s1 |
| InChIKey | FDIHGLAADZITEI-WHUPWLBISA-N |
| XLogP | 1.67 |
| TPSA | 146.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|