C16H22N6O3 — CID 123895142
9-[2,2-dimethyl-6-(propan-2-yliminomethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-amine (PubChem CID 123895142) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 9-[2,2-dimethyl-6-(propan-2-yliminomethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-amine.
| Compound Name | 9-[2,2-dimethyl-6-(propan-2-yliminomethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-amine |
|---|---|
| PubChem CID | 123895142 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 9-[2,2-dimethyl-6-(propan-2-yliminomethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-amine |
| SMILES | CC(C)/N=C/C1OC(n2cnc3c(N)ncnc32)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C16H22N6O3/c1-8(2)18-5-9-11-12(25-16(3,4)24-11)15(23-9)22-7-21-10-13(17)19-6-20-14(10)22/h5-9,11-12,15H,1-4H3,(H2,17,19,20)/b18-5+ |
| InChIKey | KEDSYCBEURZBHK-BLLMUTORSA-N |
| XLogP | 1.31 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|