C23H22N6O5 — CID 91266550
2-[3-[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-enyl]isoindole-1,3-dione (PubChem CID 91266550) has the molecular formula C23H22N6O5 and a molecular weight of 462.47 g/mol. Its IUPAC name is 2-[3-[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-enyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91266550 |
| Molecular Formula | C23H22N6O5 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 2-[3-[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-enyl]isoindole-1,3-dione |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](C=CCN1C(=O)c3ccccc3C1=O)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C23H22N6O5/c1-23(2)33-16-14(8-5-9-28-20(30)12-6-3-4-7-13(12)21(28)31)32-22(17(16)34-23)29-11-27-15-18(24)25-10-26-19(15)29/h3-8,10-11,14,16-17,22H,9H2,1-2H3,(H2,24,25,26)/t14-,16-,17-,22-/m1/s1 |
| InChIKey | WXEJKWUUYOOHLV-XCMNSTNTSA-N |
| XLogP | 1.68 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|