C29H35N7O7 — CID 118915660
[3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-1-(1,3-dioxoisoindol-2-yl)-4,4-dimethylpentan-3-yl] carbamate (PubChem CID 118915660) has the molecular formula C29H35N7O7 and a molecular weight of 593.64 g/mol. Its IUPAC name is [3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-1-(1,3-dioxoisoindol-2-yl)-4,4-dimethylpentan-3-yl] carbamate.
| Compound Name | [3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-1-(1,3-dioxoisoindol-2-yl)-4,4-dimethylpentan-3-yl] carbamate |
|---|---|
| PubChem CID | 118915660 |
| Molecular Formula | C29H35N7O7 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | [3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-1-(1,3-dioxoisoindol-2-yl)-4,4-dimethylpentan-3-yl] carbamate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CC(CCN1C(=O)c3ccccc3C1=O)(OC(N)=O)C(C)(C)C)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C29H35N7O7/c1-27(2,3)29(43-26(31)39,10-11-35-23(37)15-8-6-7-9-16(15)24(35)38)12-17-19-20(42-28(4,5)41-19)25(40-17)36-14-34-18-21(30)32-13-33-22(18)36/h6-9,13-14,17,19-20,25H,10-12H2,1-5H3,(H2,31,39)(H2,30,32,33)/t17-,19-,20-,25-,29?/m1/s1 |
| InChIKey | NVEFQAOQTXOIMO-DOJBUSBUSA-N |
| XLogP | 2.78 |
| TPSA | 187.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|