C25H30N6O5 — CID 167704307
2-[6-[(2R,3R,5R)-5-(6-aminopurin-9-yl)-2-ethyl-4-hydroxyoxolan-3-yl]oxyhexyl]isoindole-1,3-dione (PubChem CID 167704307) has the molecular formula C25H30N6O5 and a molecular weight of 494.55 g/mol. Its IUPAC name is 2-[6-[(2R,3R,5R)-5-(6-aminopurin-9-yl)-2-ethyl-4-hydroxyoxolan-3-yl]oxyhexyl]isoindole-1,3-dione.
| Compound Name | 2-[6-[(2R,3R,5R)-5-(6-aminopurin-9-yl)-2-ethyl-4-hydroxyoxolan-3-yl]oxyhexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167704307 |
| Molecular Formula | C25H30N6O5 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 2-[6-[(2R,3R,5R)-5-(6-aminopurin-9-yl)-2-ethyl-4-hydroxyoxolan-3-yl]oxyhexyl]isoindole-1,3-dione |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)C(O)[C@H]1OCCCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H30N6O5/c1-2-17-20(19(32)25(36-17)31-14-29-18-21(26)27-13-28-22(18)31)35-12-8-4-3-7-11-30-23(33)15-9-5-6-10-16(15)24(30)34/h5-6,9-10,13-14,17,19-20,25,32H,2-4,7-8,11-12H2,1H3,(H2,26,27,28)/t17-,19?,20+,25-/m1/s1 |
| InChIKey | KPCBDYPGSNZBLL-HBGHNEAOSA-N |
| XLogP | 2.32 |
| TPSA | 145.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|