C15H19F3N6O5 — CID 87800869
N-[3-[(2R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxypropyl]-2,2,2-trifluoroacetamide (PubChem CID 87800869) has the molecular formula C15H19F3N6O5 and a molecular weight of 420.35 g/mol. Its IUPAC name is N-[3-[(2R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxypropyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[(2R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxypropyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 87800869 |
| Molecular Formula | C15H19F3N6O5 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[3-[(2R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxypropyl]-2,2,2-trifluoroacetamide |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)C(OCCCNC(=O)C(F)(F)F)C1O |
| InChI | InChI=1S/C15H19F3N6O5/c16-15(17,18)14(27)20-2-1-3-28-10-7(4-25)29-13(9(10)26)24-6-23-8-11(19)21-5-22-12(8)24/h5-7,9-10,13,25-26H,1-4H2,(H,20,27)(H2,19,21,22)/t7-,9?,10?,13-/m1/s1 |
| InChIKey | ASIRDHFYRWDUEC-QQNFCMCUSA-N |
| XLogP | -0.89 |
| TPSA | 157.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|