C11H12F3N5O6S — CID 171428928
[5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] trifluoromethanesulfonate (PubChem CID 171428928) has the molecular formula C11H12F3N5O6S and a molecular weight of 399.31 g/mol. Its IUPAC name is [5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] trifluoromethanesulfonate.
| Compound Name | [5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171428928 |
| Molecular Formula | C11H12F3N5O6S |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | [5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] trifluoromethanesulfonate |
| SMILES | Nc1ncnc2c1ncn2C1OC(CO)C(OS(=O)(=O)C(F)(F)F)C1O |
| InChI | InChI=1S/C11H12F3N5O6S/c12-11(13,14)26(22,23)25-7-4(1-20)24-10(6(7)21)19-3-18-5-8(15)16-2-17-9(5)19/h2-4,6-7,10,20-21H,1H2,(H2,15,16,17) |
| InChIKey | HNYPNQCFAGGOIV-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 162.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|