C17H21F3N6O7 — CID 170318631
N-[2-[[(2R,3R,4S,5R)-2-(6-acetamidopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxymethoxy]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 170318631) has the molecular formula C17H21F3N6O7 and a molecular weight of 478.38 g/mol. Its IUPAC name is N-[2-[[(2R,3R,4S,5R)-2-(6-acetamidopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxymethoxy]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[[(2R,3R,4S,5R)-2-(6-acetamidopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxymethoxy]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 170318631 |
| Molecular Formula | C17H21F3N6O7 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | N-[2-[[(2R,3R,4S,5R)-2-(6-acetamidopurin-9-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl]oxymethoxy]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@H](O)[C@H]1OCOCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H21F3N6O7/c1-8(28)25-13-10-14(23-5-22-13)26(6-24-10)15-12(11(29)9(4-27)33-15)32-7-31-3-2-21-16(30)17(18,19)20/h5-6,9,11-12,15,27,29H,2-4,7H2,1H3,(H,21,30)(H,22,23,25,28)/t9-,11+,12-,15-/m1/s1 |
| InChIKey | BZFBGNCILRQUFH-JDTTZNEISA-N |
| XLogP | -0.93 |
| TPSA | 169.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|