C23H24F3N7O7 — CID 118653409
N-[9-[(2R,3S,5R)-4-hydroxy-5-(hydroxymethyl)-3-[2-oxo-2-[2-[(2,2,2-trifluoroacetyl)amino]ethylamino]ethoxy]oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 118653409) has the molecular formula C23H24F3N7O7 and a molecular weight of 567.48 g/mol. Its IUPAC name is N-[9-[(2R,3S,5R)-4-hydroxy-5-(hydroxymethyl)-3-[2-oxo-2-[2-[(2,2,2-trifluoroacetyl)amino]ethylamino]ethoxy]oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2R,3S,5R)-4-hydroxy-5-(hydroxymethyl)-3-[2-oxo-2-[2-[(2,2,2-trifluoroacetyl)amino]ethylamino]ethoxy]oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 118653409 |
| Molecular Formula | C23H24F3N7O7 |
| Molecular Weight | 567.48 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | N-[9-[(2R,3S,5R)-4-hydroxy-5-(hydroxymethyl)-3-[2-oxo-2-[2-[(2,2,2-trifluoroacetyl)amino]ethylamino]ethoxy]oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | O=C(CO[C@H]1C(O)[C@@H](CO)O[C@H]1n1cnc2c(NC(=O)c3ccccc3)ncnc21)NCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C23H24F3N7O7/c24-23(25,26)22(38)28-7-6-27-14(35)9-39-17-16(36)13(8-34)40-21(17)33-11-31-15-18(29-10-30-19(15)33)32-20(37)12-4-2-1-3-5-12/h1-5,10-11,13,16-17,21,34,36H,6-9H2,(H,27,35)(H,28,38)(H,29,30,32,37)/t13-,16?,17+,21-/m1/s1 |
| InChIKey | FQWWEYYWAOCWMV-MYKSREJTSA-N |
| XLogP | -0.49 |
| TPSA | 189.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.48 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|