C24H27F3N6O8 — CID 146322699
N-[9-[(3R,4R)-4-hydroxy-5-(hydroxymethyl)-3-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxymethoxy]oxolan-2-yl]purin-6-yl]benzamide (PubChem CID 146322699) has the molecular formula C24H27F3N6O8 and a molecular weight of 584.51 g/mol. Its IUPAC name is N-[9-[(3R,4R)-4-hydroxy-5-(hydroxymethyl)-3-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxymethoxy]oxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(3R,4R)-4-hydroxy-5-(hydroxymethyl)-3-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxymethoxy]oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 146322699 |
| Molecular Formula | C24H27F3N6O8 |
| Molecular Weight | 584.51 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | N-[9-[(3R,4R)-4-hydroxy-5-(hydroxymethyl)-3-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxymethoxy]oxolan-2-yl]purin-6-yl]benzamide |
| SMILES | O=C(Nc1ncnc2c1ncn2C1OC(CO)[C@@H](O)[C@H]1OCOCCOCCNC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C24H27F3N6O8/c25-24(26,27)23(37)28-6-7-38-8-9-39-13-40-18-17(35)15(10-34)41-22(18)33-12-31-16-19(29-11-30-20(16)33)32-21(36)14-4-2-1-3-5-14/h1-5,11-12,15,17-18,22,34-35H,6-10,13H2,(H,28,37)(H,29,30,32,36)/t15?,17-,18-,22?/m1/s1 |
| InChIKey | DUXWUNASAPHEKR-WDJLUERYSA-N |
| XLogP | 0.38 |
| TPSA | 179.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.51 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|