C14H17F3N6O4 — CID 14859821
2,2,2-trifluoro-N-[2-[[9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]ethyl]acetamide (PubChem CID 14859821) has the molecular formula C14H17F3N6O4 and a molecular weight of 390.32 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[[9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[[9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 14859821 |
| Molecular Formula | C14H17F3N6O4 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[[9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]ethyl]acetamide |
| SMILES | O=C(NCCNc1ncnc2c1ncn2C1CC(O)C(CO)O1)C(F)(F)F |
| InChI | InChI=1S/C14H17F3N6O4/c15-14(16,17)13(26)19-2-1-18-11-10-12(21-5-20-11)23(6-22-10)9-3-7(25)8(4-24)27-9/h5-9,24-25H,1-4H2,(H,19,26)(H,18,20,21) |
| InChIKey | WFYJRVPMRKAPQJ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|