C21H29N7O7 — CID 154777147
2,6-diamino-5-[(E)-3-[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-enoyl]oxyhexanoic acid (PubChem CID 154777147) has the molecular formula C21H29N7O7 and a molecular weight of 491.51 g/mol. Its IUPAC name is 2,6-diamino-5-[(E)-3-[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-enoyl]oxyhexanoic acid.
| Compound Name | 2,6-diamino-5-[(E)-3-[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-enoyl]oxyhexanoic acid |
|---|---|
| PubChem CID | 154777147 |
| Molecular Formula | C21H29N7O7 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 2,6-diamino-5-[(E)-3-[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-enoyl]oxyhexanoic acid |
| SMILES | CC1(C)OC2C(/C=C/C(=O)OC(CN)CCC(N)C(=O)O)OC(n3cnc4c(N)ncnc43)C2O1 |
| InChI | InChI=1S/C21H29N7O7/c1-21(2)34-15-12(5-6-13(29)32-10(7-22)3-4-11(23)20(30)31)33-19(16(15)35-21)28-9-27-14-17(24)25-8-26-18(14)28/h5-6,8-12,15-16,19H,3-4,7,22-23H2,1-2H3,(H,30,31)(H2,24,25,26)/b6-5+ |
| InChIKey | LUCFYONNKXEXPH-AATRIKPKSA-N |
| XLogP | -0.56 |
| TPSA | 212.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|