C13H18N5O7P — CID 174007229
[(5S,7R)-7-(2-amino-6-oxo-1H-purin-9-yl)-5-ethyl-2,6-dioxabicyclo[3.2.1]octan-8-yl] dihydrogen phosphate (PubChem CID 174007229) has the molecular formula C13H18N5O7P and a molecular weight of 387.29 g/mol. Its IUPAC name is [(5S,7R)-7-(2-amino-6-oxo-1H-purin-9-yl)-5-ethyl-2,6-dioxabicyclo[3.2.1]octan-8-yl] dihydrogen phosphate.
| Compound Name | [(5S,7R)-7-(2-amino-6-oxo-1H-purin-9-yl)-5-ethyl-2,6-dioxabicyclo[3.2.1]octan-8-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 174007229 |
| Molecular Formula | C13H18N5O7P |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | [(5S,7R)-7-(2-amino-6-oxo-1H-purin-9-yl)-5-ethyl-2,6-dioxabicyclo[3.2.1]octan-8-yl] dihydrogen phosphate |
| SMILES | CC[C@]12CCOC(C1OP(=O)(O)O)[C@H](n1cnc3c(=O)[nH]c(N)nc31)O2 |
| InChI | InChI=1S/C13H18N5O7P/c1-2-13-3-4-23-7(8(13)25-26(20,21)22)11(24-13)18-5-15-6-9(18)16-12(14)17-10(6)19/h5,7-8,11H,2-4H2,1H3,(H2,20,21,22)(H3,14,16,17,19)/t7?,8?,11-,13+/m1/s1 |
| InChIKey | ZVOZILWGOYDYKC-OQJZRBJLSA-N |
| XLogP | -0.35 |
| TPSA | 174.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|