C19H29N5O4 — CID 158344429
2-amino-9-[(1S,3R,4R,7S)-1-(2,2-dimethylpropyl)-7-[(2-methylpropan-2-yl)oxy]-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-1H-purin-6-one (PubChem CID 158344429) has the molecular formula C19H29N5O4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-amino-9-[(1S,3R,4R,7S)-1-(2,2-dimethylpropyl)-7-[(2-methylpropan-2-yl)oxy]-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1S,3R,4R,7S)-1-(2,2-dimethylpropyl)-7-[(2-methylpropan-2-yl)oxy]-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 158344429 |
| Molecular Formula | C19H29N5O4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | 2-amino-9-[(1S,3R,4R,7S)-1-(2,2-dimethylpropyl)-7-[(2-methylpropan-2-yl)oxy]-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-1H-purin-6-one |
| SMILES | CC(C)(C)C[C@@]12CO[C@@H]([C@H](n3cnc4c(=O)[nH]c(N)nc43)O1)[C@@H]2OC(C)(C)C |
| InChI | InChI=1S/C19H29N5O4/c1-17(2,3)7-19-8-26-11(12(19)27-18(4,5)6)15(28-19)24-9-21-10-13(24)22-16(20)23-14(10)25/h9,11-12,15H,7-8H2,1-6H3,(H3,20,22,23,25)/t11-,12+,15-,19+/m1/s1 |
| InChIKey | KTSWYIMLBXZSSG-NZMVCBSFSA-N |
| XLogP | 1.99 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |