C14H22N5O5PS — CID 163689829
9-[(2R)-4-dihydroxyphosphinothioyloxy-5,5-diethyl-3-methoxyoxolan-2-yl]purin-6-amine (PubChem CID 163689829) has the molecular formula C14H22N5O5PS and a molecular weight of 403.40 g/mol. Its IUPAC name is 9-[(2R)-4-dihydroxyphosphinothioyloxy-5,5-diethyl-3-methoxyoxolan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R)-4-dihydroxyphosphinothioyloxy-5,5-diethyl-3-methoxyoxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 163689829 |
| Molecular Formula | C14H22N5O5PS |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 9-[(2R)-4-dihydroxyphosphinothioyloxy-5,5-diethyl-3-methoxyoxolan-2-yl]purin-6-amine |
| SMILES | CCC1(CC)O[C@@H](n2cnc3c(N)ncnc32)C(OC)C1OP(O)(O)=S |
| InChI | InChI=1S/C14H22N5O5PS/c1-4-14(5-2)10(24-25(20,21)26)9(22-3)13(23-14)19-7-18-8-11(15)16-6-17-12(8)19/h6-7,9-10,13H,4-5H2,1-3H3,(H2,15,16,17)(H2,20,21,26)/t9?,10?,13-/m1/s1 |
| InChIKey | JSAMGELQBUUTHJ-SRHKJQAYSA-N |
| XLogP | 1.11 |
| TPSA | 137.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|