C12H19N6O12P3 — CID 90125369
[[(1R,3R,4R,7S)-3-(2,6-diaminopurin-9-yl)-7-hydroxy-2-oxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90125369) has the molecular formula C12H19N6O12P3 and a molecular weight of 532.24 g/mol. Its IUPAC name is [[(1R,3R,4R,7S)-3-(2,6-diaminopurin-9-yl)-7-hydroxy-2-oxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1R,3R,4R,7S)-3-(2,6-diaminopurin-9-yl)-7-hydroxy-2-oxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90125369 |
| Molecular Formula | C12H19N6O12P3 |
| Molecular Weight | 532.24 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | [[(1R,3R,4R,7S)-3-(2,6-diaminopurin-9-yl)-7-hydroxy-2-oxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1nc(N)c2ncn([C@@H]3O[C@@]4(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)CC[C@@H]3[C@@H]4O)c2n1 |
| InChI | InChI=1S/C12H19N6O12P3/c13-8-6-9(17-11(14)16-8)18(4-15-6)10-5-1-2-12(28-10,7(5)19)3-27-32(23,24)30-33(25,26)29-31(20,21)22/h4-5,7,10,19H,1-3H2,(H,23,24)(H,25,26)(H2,20,21,22)(H4,13,14,16,17)/t5-,7+,10-,12-/m1/s1 |
| InChIKey | BZNYKBPWQQNENR-OEBFKYMWSA-N |
| XLogP | -0.63 |
| TPSA | 284.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.24 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|