C11H16FN2O14P3 — CID 90125326
[[(1R,3R,4R,7S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-7-hydroxy-2-oxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90125326) has the molecular formula C11H16FN2O14P3 and a molecular weight of 512.17 g/mol. Its IUPAC name is [[(1R,3R,4R,7S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-7-hydroxy-2-oxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1R,3R,4R,7S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-7-hydroxy-2-oxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90125326 |
| Molecular Formula | C11H16FN2O14P3 |
| Molecular Weight | 512.17 g/mol |
| Exact Mass | 511.98 |
| IUPAC Name | [[(1R,3R,4R,7S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-7-hydroxy-2-oxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@@]3(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)CC[C@@H]2[C@@H]3O)cc1F |
| InChI | InChI=1S/C11H16FN2O14P3/c12-6-3-14(10(17)13-8(6)16)9-5-1-2-11(26-9,7(5)15)4-25-30(21,22)28-31(23,24)27-29(18,19)20/h3,5,7,9,15H,1-2,4H2,(H,21,22)(H,23,24)(H,13,16,17)(H2,18,19,20)/t5-,7+,9-,11-/m1/s1 |
| InChIKey | PTUXXEYFZQODMS-UJMAXOFFSA-N |
| XLogP | -0.94 |
| TPSA | 244.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.17 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|