C11H15FN3O14P3 — CID 90445159
[[(2R,3S,4R,5R)-4-cyano-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90445159) has the molecular formula C11H15FN3O14P3 and a molecular weight of 525.17 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-4-cyano-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-4-cyano-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90445159 |
| Molecular Formula | C11H15FN3O14P3 |
| Molecular Weight | 525.17 g/mol |
| Exact Mass | 524.98 |
| IUPAC Name | [[(2R,3S,4R,5R)-4-cyano-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@@]1(C#N)[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15FN3O14P3/c1-11(4-13)7(16)6(27-9(11)15-2-5(12)8(17)14-10(15)18)3-26-31(22,23)29-32(24,25)28-30(19,20)21/h2,6-7,9,16H,3H2,1H3,(H,22,23)(H,24,25)(H,14,17,18)(H2,19,20,21)/t6-,7-,9-,11-/m1/s1 |
| InChIKey | ONFUWOUPFAZDMR-LUQPRHOASA-N |
| XLogP | -1.19 |
| TPSA | 267.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.17 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|