C11H13F2N2O13P3S — CID 122449792
[[(2R,3S,5R)-4-ethynyl-3-fluoro-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 122449792) has the molecular formula C11H13F2N2O13P3S and a molecular weight of 544.21 g/mol. Its IUPAC name is [[(2R,3S,5R)-4-ethynyl-3-fluoro-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-4-ethynyl-3-fluoro-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122449792 |
| Molecular Formula | C11H13F2N2O13P3S |
| Molecular Weight | 544.21 g/mol |
| Exact Mass | 543.93 |
| IUPAC Name | [[(2R,3S,5R)-4-ethynyl-3-fluoro-5-(5-fluoro-4-oxo-2-sulfanylidenepyrimidin-1-yl)-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#CC1(O)[C@@H](F)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cc(F)c(=O)[nH]c1=S |
| InChI | InChI=1S/C11H13F2N2O13P3S/c1-2-11(17)7(13)6(26-9(11)15-3-5(12)8(16)14-10(15)32)4-25-30(21,22)28-31(23,24)27-29(18,19)20/h1,3,6-7,9,17H,4H2,(H,21,22)(H,23,24)(H,14,16,32)(H2,18,19,20)/t6-,7+,9-,11?/m1/s1 |
| InChIKey | ASLZXFHJUVOVFW-XNODMDPTSA-N |
| XLogP | -0.01 |
| TPSA | 227.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.21 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|