C11H14FN2O13P3S — CID 122449793
[[(2R,3S,5R)-4-ethynyl-3-fluoro-4-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 122449793) has the molecular formula C11H14FN2O13P3S and a molecular weight of 526.22 g/mol. Its IUPAC name is [[(2R,3S,5R)-4-ethynyl-3-fluoro-4-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-4-ethynyl-3-fluoro-4-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122449793 |
| Molecular Formula | C11H14FN2O13P3S |
| Molecular Weight | 526.22 g/mol |
| Exact Mass | 525.94 |
| IUPAC Name | [[(2R,3S,5R)-4-ethynyl-3-fluoro-4-hydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#CC1(O)[C@@H](F)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1ccc(=S)[nH]c1=O |
| InChI | InChI=1S/C11H14FN2O13P3S/c1-2-11(16)8(12)6(25-9(11)14-4-3-7(31)13-10(14)15)5-24-29(20,21)27-30(22,23)26-28(17,18)19/h1,3-4,6,8-9,16H,5H2,(H,20,21)(H,22,23)(H,13,15,31)(H2,17,18,19)/t6-,8+,9-,11?/m1/s1 |
| InChIKey | XYHGXHSZROYMDF-MNYIIIIRSA-N |
| XLogP | -0.15 |
| TPSA | 227.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.22 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|