C11H15N2O14P3S — CID 122449754
[[(2R,3R,5R)-2-ethynyl-3,4-dihydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 122449754) has the molecular formula C11H15N2O14P3S and a molecular weight of 524.23 g/mol. Its IUPAC name is [[(2R,3R,5R)-2-ethynyl-3,4-dihydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5R)-2-ethynyl-3,4-dihydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122449754 |
| Molecular Formula | C11H15N2O14P3S |
| Molecular Weight | 524.23 g/mol |
| Exact Mass | 523.95 |
| IUPAC Name | [[(2R,3R,5R)-2-ethynyl-3,4-dihydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#C[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](n2ccc(=S)[nH]c2=O)C(O)[C@H]1O |
| InChI | InChI=1S/C11H15N2O14P3S/c1-2-11(5-24-29(20,21)27-30(22,23)26-28(17,18)19)8(15)7(14)9(25-11)13-4-3-6(31)12-10(13)16/h1,3-4,7-9,14-15H,5H2,(H,20,21)(H,22,23)(H,12,16,31)(H2,17,18,19)/t7?,8-,9-,11-/m1/s1 |
| InChIKey | MMCCHYTYASJOFS-ILFLCMMHSA-N |
| XLogP | -1.13 |
| TPSA | 247.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.23 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|