C12H16FN2O13P3S — CID 123161541
[[2-ethynyl-5-(5-fluoro-2-methylidene-4-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 123161541) has the molecular formula C12H16FN2O13P3S and a molecular weight of 540.25 g/mol. Its IUPAC name is [[2-ethynyl-5-(5-fluoro-2-methylidene-4-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[2-ethynyl-5-(5-fluoro-2-methylidene-4-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 123161541 |
| Molecular Formula | C12H16FN2O13P3S |
| Molecular Weight | 540.25 g/mol |
| Exact Mass | 539.96 |
| IUPAC Name | [[2-ethynyl-5-(5-fluoro-2-methylidene-4-sulfanylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#CC1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OC(N2C=C(F)C(=S)NC2=C)C(O)C1O |
| InChI | InChI=1S/C12H16FN2O13P3S/c1-3-12(5-25-30(21,22)28-31(23,24)27-29(18,19)20)9(17)8(16)11(26-12)15-4-7(13)10(32)14-6(15)2/h1,4,8-9,11,16-17H,2,5H2,(H,14,32)(H,21,22)(H,23,24)(H2,18,19,20) |
| InChIKey | MFFTWARAHXSFFT-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 224.78 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.25 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|