C12H16FN2O14P3 — CID 90251428
[[(2S,3S,4R,5R)-4-ethynyl-2-fluoro-3,4-dihydroxy-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90251428) has the molecular formula C12H16FN2O14P3 and a molecular weight of 524.18 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-4-ethynyl-2-fluoro-3,4-dihydroxy-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3S,4R,5R)-4-ethynyl-2-fluoro-3,4-dihydroxy-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90251428 |
| Molecular Formula | C12H16FN2O14P3 |
| Molecular Weight | 524.18 g/mol |
| Exact Mass | 523.98 |
| IUPAC Name | [[(2S,3S,4R,5R)-4-ethynyl-2-fluoro-3,4-dihydroxy-5-(2-methylidene-4-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#C[C@]1(O)[C@H](N2C=CC(=O)NC2=C)O[C@](F)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H]1O |
| InChI | InChI=1S/C12H16FN2O14P3/c1-3-11(18)9(17)12(13,27-10(11)15-5-4-8(16)14-7(15)2)6-26-31(22,23)29-32(24,25)28-30(19,20)21/h1,4-5,9-10,17-18H,2,6H2,(H,14,16)(H,22,23)(H,24,25)(H2,19,20,21)/t9-,10+,11+,12+/m0/s1 |
| InChIKey | WAPWWDZTUYBVRL-IRCOFANPSA-N |
| XLogP | -1.51 |
| TPSA | 241.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.18 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|